C9H10N2 — CID 156718353
2-methyl-1,8a-dihydro-1,5-naphthyridine (PubChem CID 156718353) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-methyl-1,8a-dihydro-1,5-naphthyridine.
| Compound Name | 2-methyl-1,8a-dihydro-1,5-naphthyridine |
|---|---|
| PubChem CID | 156718353 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-methyl-1,8a-dihydro-1,5-naphthyridine |
| SMILES | CC1=CC=C2N=CC=CC2N1 |
| InChI | InChI=1S/C9H10N2/c1-7-4-5-8-9(11-7)3-2-6-10-8/h2-6,9,11H,1H3 |
| InChIKey | FGGDTTHLHGBGRD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |