C11H21NO — CID 156720193
2-[(2R,3R)-1-ethenyl-2,3-dimethylpiperidin-4-yl]ethanol (PubChem CID 156720193) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-[(2R,3R)-1-ethenyl-2,3-dimethylpiperidin-4-yl]ethanol.
| Compound Name | 2-[(2R,3R)-1-ethenyl-2,3-dimethylpiperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 156720193 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-[(2R,3R)-1-ethenyl-2,3-dimethylpiperidin-4-yl]ethanol |
| SMILES | C=CN1CCC(CCO)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C11H21NO/c1-4-12-7-5-11(6-8-13)9(2)10(12)3/h4,9-11,13H,1,5-8H2,2-3H3/t9-,10+,11?/m0/s1 |
| InChIKey | TUHGOWBEIRSGCH-MTULOOOASA-N |
| XLogP | 1.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |