C22H31Cl2FN2O4 — CID 156723247
tert-butyl 4-[[3,4-dichloro-6-(diethylcarbamoyloxy)-2-fluorophenyl]methyl]piperidine-1-carboxylate (PubChem CID 156723247) has the molecular formula C22H31Cl2FN2O4 and a molecular weight of 477.40 g/mol. Its IUPAC name is tert-butyl 4-[[3,4-dichloro-6-(diethylcarbamoyloxy)-2-fluorophenyl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3,4-dichloro-6-(diethylcarbamoyloxy)-2-fluorophenyl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156723247 |
| Molecular Formula | C22H31Cl2FN2O4 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | tert-butyl 4-[[3,4-dichloro-6-(diethylcarbamoyloxy)-2-fluorophenyl]methyl]piperidine-1-carboxylate |
| SMILES | CCN(CC)C(=O)Oc1cc(Cl)c(Cl)c(F)c1CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H31Cl2FN2O4/c1-6-26(7-2)20(28)30-17-13-16(23)18(24)19(25)15(17)12-14-8-10-27(11-9-14)21(29)31-22(3,4)5/h13-14H,6-12H2,1-5H3 |
| InChIKey | RXKMVSNFYMJKAW-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|