C15H14Cl2N2O — CID 156723606
5-(2,3-dichloro-6-methoxyphenyl)pyridine-2-carbonitrile;ethane (PubChem CID 156723606) has the molecular formula C15H14Cl2N2O and a molecular weight of 309.20 g/mol. Its IUPAC name is 5-(2,3-dichloro-6-methoxyphenyl)pyridine-2-carbonitrile;ethane.
| Compound Name | 5-(2,3-dichloro-6-methoxyphenyl)pyridine-2-carbonitrile;ethane |
|---|---|
| PubChem CID | 156723606 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-(2,3-dichloro-6-methoxyphenyl)pyridine-2-carbonitrile;ethane |
| SMILES | CC.COc1ccc(Cl)c(Cl)c1-c1ccc(C#N)nc1 |
| InChI | InChI=1S/C13H8Cl2N2O.C2H6/c1-18-11-5-4-10(14)13(15)12(11)8-2-3-9(6-16)17-7-8;1-2/h2-5,7H,1H3;1-2H3 |
| InChIKey | PRRQBHQPNVGGPO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |