C19H21BrO4 — CID 156725463
methyl (E,2E)-3-[(5-bromo-1-benzofuran-3-yl)methoxy]-2-propylidenehex-3-enoate (PubChem CID 156725463) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is methyl (E,2E)-3-[(5-bromo-1-benzofuran-3-yl)methoxy]-2-propylidenehex-3-enoate.
| Compound Name | methyl (E,2E)-3-[(5-bromo-1-benzofuran-3-yl)methoxy]-2-propylidenehex-3-enoate |
|---|---|
| PubChem CID | 156725463 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | methyl (E,2E)-3-[(5-bromo-1-benzofuran-3-yl)methoxy]-2-propylidenehex-3-enoate |
| SMILES | CC/C=C(OCc1coc2ccc(Br)cc12)\C(=C/CC)C(=O)OC |
| InChI | InChI=1S/C19H21BrO4/c1-4-6-15(19(21)22-3)17(7-5-2)23-11-13-12-24-18-9-8-14(20)10-16(13)18/h6-10,12H,4-5,11H2,1-3H3/b15-6+,17-7+ |
| InChIKey | UDONJUWYEGMZMD-DSXAEZSQSA-N |
| XLogP | 5.52 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|