C17H15BrN2O4S — CID 18861075
2-(5-bromo-1-benzofuran-3-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide (PubChem CID 18861075) has the molecular formula C17H15BrN2O4S and a molecular weight of 423.29 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-3-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide.
| Compound Name | 2-(5-bromo-1-benzofuran-3-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18861075 |
| Molecular Formula | C17H15BrN2O4S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-3-yl)-N-[(4-sulfamoylphenyl)methyl]acetamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)Cc2coc3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C17H15BrN2O4S/c18-13-3-6-16-15(8-13)12(10-24-16)7-17(21)20-9-11-1-4-14(5-2-11)25(19,22)23/h1-6,8,10H,7,9H2,(H,20,21)(H2,19,22,23) |
| InChIKey | LPOQMKUGFRZSKC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |