C13H11BrCl2O3 — CID 67612249
ethyl 2-(5-bromo-1-benzofuran-3-yl)-3,3-dichloropropanoate (PubChem CID 67612249) has the molecular formula C13H11BrCl2O3 and a molecular weight of 366.04 g/mol. Its IUPAC name is ethyl 2-(5-bromo-1-benzofuran-3-yl)-3,3-dichloropropanoate.
| Compound Name | ethyl 2-(5-bromo-1-benzofuran-3-yl)-3,3-dichloropropanoate |
|---|---|
| PubChem CID | 67612249 |
| Molecular Formula | C13H11BrCl2O3 |
| Molecular Weight | 366.04 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | ethyl 2-(5-bromo-1-benzofuran-3-yl)-3,3-dichloropropanoate |
| SMILES | CCOC(=O)C(c1coc2ccc(Br)cc12)C(Cl)Cl |
| InChI | InChI=1S/C13H11BrCl2O3/c1-2-18-13(17)11(12(15)16)9-6-19-10-4-3-7(14)5-8(9)10/h3-6,11-12H,2H2,1H3 |
| InChIKey | GIDZXJNPLJKHGM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|