C33H38ClN3O3 — CID 156733057
ethyl (2S)-2-amino-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]propanoate (PubChem CID 156733057) has the molecular formula C33H38ClN3O3 and a molecular weight of 560.14 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-amino-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 156733057 |
| Molecular Formula | C33H38ClN3O3 |
| Molecular Weight | 560.14 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | ethyl (2S)-2-amino-3-[4-[3-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]propoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(OCCCN2CCC(=C3c4ccc(Cl)cc4CCc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C33H38ClN3O3/c1-2-39-33(38)30(35)21-23-6-11-28(12-7-23)40-20-4-17-37-18-14-24(15-19-37)31-29-13-10-27(34)22-26(29)9-8-25-5-3-16-36-32(25)31/h3,5-7,10-13,16,22,30H,2,4,8-9,14-15,17-21,35H2,1H3/t30-/m0/s1 |
| InChIKey | VZMGJAVWBMGKKT-PMERELPUSA-N |
| XLogP | 5.63 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.14 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|