C24H28ClN3O2 — CID 178031550
5-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-N-hydroxypentanamide (PubChem CID 178031550) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 5-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 178031550 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-N-hydroxypentanamide |
| SMILES | O=C(CCCCN1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1)NO |
| InChI | InChI=1S/C24H28ClN3O2/c25-20-8-9-21-19(16-20)7-6-18-4-3-12-26-24(18)23(21)17-10-14-28(15-11-17)13-2-1-5-22(29)27-30/h3-4,8-9,12,16,30H,1-2,5-7,10-11,13-15H2,(H,27,29) |
| InChIKey | VMMCCQMCKXMDRT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|