C43H60N4O2 — CID 156736733
[3-[5-[3-[3-(4,5-dihydro-3H-pyridazin-2-yl)but-3-enyl]-5-methylphenyl]-2-[(3Z,5Z)-6,7-dimethylnona-1,3,5-trien-5-yl]-1-ethylindol-3-yl]-2,2-dimethylpropyl] formate;methanamine (PubChem CID 156736733) has the molecular formula C43H60N4O2 and a molecular weight of 664.98 g/mol. Its IUPAC name is [3-[5-[3-[3-(4,5-dihydro-3H-pyridazin-2-yl)but-3-enyl]-5-methylphenyl]-2-[(3Z,5Z)-6,7-dimethylnona-1,3,5-trien-5-yl]-1-ethylindol-3-yl]-2,2-dimethylpropyl] formate;methanamine.
| Compound Name | [3-[5-[3-[3-(4,5-dihydro-3H-pyridazin-2-yl)but-3-enyl]-5-methylphenyl]-2-[(3Z,5Z)-6,7-dimethylnona-1,3,5-trien-5-yl]-1-ethylindol-3-yl]-2,2-dimethylpropyl] formate;methanamine |
|---|---|
| PubChem CID | 156736733 |
| Molecular Formula | C43H60N4O2 |
| Molecular Weight | 664.98 g/mol |
| Exact Mass | 664.47 |
| IUPAC Name | [3-[5-[3-[3-(4,5-dihydro-3H-pyridazin-2-yl)but-3-enyl]-5-methylphenyl]-2-[(3Z,5Z)-6,7-dimethylnona-1,3,5-trien-5-yl]-1-ethylindol-3-yl]-2,2-dimethylpropyl] formate;methanamine |
| SMILES | C=C/C=C\C(=C(/C)C(C)CC)c1c(CC(C)(C)COC=O)c2cc(-c3cc(C)cc(CCC(=C)N4CCCC=N4)c3)ccc2n1CC.CN |
| InChI | InChI=1S/C42H55N3O2.CH5N/c1-10-13-16-37(33(7)31(5)11-2)41-39(27-42(8,9)28-47-29-46)38-26-35(19-20-40(38)44(41)12-3)36-24-30(4)23-34(25-36)18-17-32(6)45-22-15-14-21-43-45;1-2/h10,13,16,19-21,23-26,29,31H,1,6,11-12,14-15,17-18,22,27-28H2,2-5,7-9H3;2H2,1H3/b16-13-,37-33-; |
| InChIKey | OKWNDDJKFGNYAB-TYICQHEWSA-N |
| XLogP | 10.04 |
| TPSA | 72.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.98 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|