C8H14F2N2O — CID 156736872
3,4-difluoro-N,N,1-trimethylpyrrolidine-3-carboxamide (PubChem CID 156736872) has the molecular formula C8H14F2N2O and a molecular weight of 192.21 g/mol. Its IUPAC name is 3,4-difluoro-N,N,1-trimethylpyrrolidine-3-carboxamide.
| Compound Name | 3,4-difluoro-N,N,1-trimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 156736872 |
| Molecular Formula | C8H14F2N2O |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3,4-difluoro-N,N,1-trimethylpyrrolidine-3-carboxamide |
| SMILES | CN1CC(F)C(F)(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C8H14F2N2O/c1-11(2)7(13)8(10)5-12(3)4-6(8)9/h6H,4-5H2,1-3H3 |
| InChIKey | QOPSZZJGXUYPAK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |