C10H22N2O2 — CID 171516586
ethane;3-hydroxy-N,N,1-trimethylpyrrolidine-3-carboxamide (PubChem CID 171516586) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is ethane;3-hydroxy-N,N,1-trimethylpyrrolidine-3-carboxamide.
| Compound Name | ethane;3-hydroxy-N,N,1-trimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171516586 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethane;3-hydroxy-N,N,1-trimethylpyrrolidine-3-carboxamide |
| SMILES | CC.CN1CCC(O)(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C8H16N2O2.C2H6/c1-9(2)7(11)8(12)4-5-10(3)6-8;1-2/h12H,4-6H2,1-3H3;1-2H3 |
| InChIKey | HDMHXTPURVUTKW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |