C22H30F3N3O4S3 — CID 156737141
4-(amino-methylidene-oxo-λ6-sulfanyl)-2-(trifluoromethylsulfonyl)aniline;4-(4-phenylsulfanylbutyl)morpholine (PubChem CID 156737141) has the molecular formula C22H30F3N3O4S3 and a molecular weight of 553.69 g/mol. Its IUPAC name is 4-(amino-methylidene-oxo-λ6-sulfanyl)-2-(trifluoromethylsulfonyl)aniline;4-(4-phenylsulfanylbutyl)morpholine.
| Compound Name | 4-(amino-methylidene-oxo-λ6-sulfanyl)-2-(trifluoromethylsulfonyl)aniline;4-(4-phenylsulfanylbutyl)morpholine |
|---|---|
| PubChem CID | 156737141 |
| Molecular Formula | C22H30F3N3O4S3 |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 4-(amino-methylidene-oxo-λ6-sulfanyl)-2-(trifluoromethylsulfonyl)aniline;4-(4-phenylsulfanylbutyl)morpholine |
| SMILES | C=S(N)(=O)c1ccc(N)c(S(=O)(=O)C(F)(F)F)c1.c1ccc(SCCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C14H21NOS.C8H9F3N2O3S2/c1-2-6-14(7-3-1)17-13-5-4-8-15-9-11-16-12-10-15;1-17(13,14)5-2-3-6(12)7(4-5)18(15,16)8(9,10)11/h1-3,6-7H,4-5,8-13H2;2-4H,1,12H2,(H2,13,14) |
| InChIKey | JABSTYKZLMJGEZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|