C21H31N3O4 — CID 156738344
5-oxo-5-[2-[4-(N-propanoylanilino)piperidin-1-yl]ethylamino]pentanoic acid (PubChem CID 156738344) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-oxo-5-[2-[4-(N-propanoylanilino)piperidin-1-yl]ethylamino]pentanoic acid.
| Compound Name | 5-oxo-5-[2-[4-(N-propanoylanilino)piperidin-1-yl]ethylamino]pentanoic acid |
|---|---|
| PubChem CID | 156738344 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 5-oxo-5-[2-[4-(N-propanoylanilino)piperidin-1-yl]ethylamino]pentanoic acid |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(CCNC(=O)CCCC(=O)O)CC1 |
| InChI | InChI=1S/C21H31N3O4/c1-2-20(26)24(17-7-4-3-5-8-17)18-11-14-23(15-12-18)16-13-22-19(25)9-6-10-21(27)28/h3-5,7-8,18H,2,6,9-16H2,1H3,(H,22,25)(H,27,28) |
| InChIKey | LRWXHJDEGLIXGC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |