C29H51N — CID 156738355
(14S)-N,3,10,13,14-pentamethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-amine (PubChem CID 156738355) has the molecular formula C29H51N and a molecular weight of 413.73 g/mol. Its IUPAC name is (14S)-N,3,10,13,14-pentamethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-amine.
| Compound Name | (14S)-N,3,10,13,14-pentamethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-amine |
|---|---|
| PubChem CID | 156738355 |
| Molecular Formula | C29H51N |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 413.40 |
| IUPAC Name | (14S)-N,3,10,13,14-pentamethyl-17-(5-methylhexyl)-2,3,4,7,8,9,11,12,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-amine |
| SMILES | CNC1(CCCCC(C)C)CC[C@@]2(C)C3CC=C4CC(C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C29H51N/c1-21(2)10-8-9-15-29(30-7)19-18-27(5)25-12-11-23-20-22(3)13-16-26(23,4)24(25)14-17-28(27,29)6/h11,21-22,24-25,30H,8-10,12-20H2,1-7H3/t22?,24?,25?,26?,27-,28?,29?/m0/s1 |
| InChIKey | UUZVMNRXUKCZBA-XXKKOKABSA-N |
| XLogP | 8.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|