C27H25F5N4O5S — CID 156742514
N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl]formamide;2,3,4,5,6-pentafluoro-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 156742514) has the molecular formula C27H25F5N4O5S and a molecular weight of 612.58 g/mol. Its IUPAC name is N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl]formamide;2,3,4,5,6-pentafluoro-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl]formamide;2,3,4,5,6-pentafluoro-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 156742514 |
| Molecular Formula | C27H25F5N4O5S |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-1H-pyrazol-3-yl]formamide;2,3,4,5,6-pentafluoro-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(CCc2cc(NC=O)n[nH]2)cc(OC)c1.Cc1ccccc1NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H17N3O3.C13H8F5NO2S/c1-19-12-5-10(6-13(8-12)20-2)3-4-11-7-14(15-9-18)17-16-11;1-6-4-2-3-5-7(6)19-22(20,21)13-11(17)9(15)8(14)10(16)12(13)18/h5-9H,3-4H2,1-2H3,(H2,15,16,17,18);2-5,19H,1H3 |
| InChIKey | DZAZGWMRLNWHIA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|