C47H87N — CID 156749378
(Z)-8-[3-(2-ethyl-4-methylcyclopenten-1-yl)propyl]-5,11-dimethylidene-N,N-dipropyloctacos-22-en-1-amine (PubChem CID 156749378) has the molecular formula C47H87N and a molecular weight of 666.22 g/mol. Its IUPAC name is (Z)-8-[3-(2-ethyl-4-methylcyclopenten-1-yl)propyl]-5,11-dimethylidene-N,N-dipropyloctacos-22-en-1-amine.
| Compound Name | (Z)-8-[3-(2-ethyl-4-methylcyclopenten-1-yl)propyl]-5,11-dimethylidene-N,N-dipropyloctacos-22-en-1-amine |
|---|---|
| PubChem CID | 156749378 |
| Molecular Formula | C47H87N |
| Molecular Weight | 666.22 g/mol |
| Exact Mass | 665.68 |
| IUPAC Name | (Z)-8-[3-(2-ethyl-4-methylcyclopenten-1-yl)propyl]-5,11-dimethylidene-N,N-dipropyloctacos-22-en-1-amine |
| SMILES | C=C(CCCCCCCCCC/C=C\CCCCC)CCC(CCCC1=C(CC)CC(C)C1)CCC(=C)CCCCN(CCC)CCC |
| InChI | InChI=1S/C47H87N/c1-8-12-13-14-15-16-17-18-19-20-21-22-23-24-25-29-42(5)33-35-45(31-28-32-47-41-44(7)40-46(47)11-4)36-34-43(6)30-26-27-39-48(37-9-2)38-10-3/h15-16,44-45H,5-6,8-14,17-41H2,1-4,7H3/b16-15- |
| InChIKey | PSYDXWRQLXMUDJ-NXVVXOECSA-N |
| XLogP | 15.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.22 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|