C38H73N — CID 170072291
(13Z,16E)-3-(9,10-dimethyl-6-methylideneundecyl)-N-ethyl-N-methylhenicosa-13,16-dien-1-amine (PubChem CID 170072291) has the molecular formula C38H73N and a molecular weight of 544.01 g/mol. Its IUPAC name is (13Z,16E)-3-(9,10-dimethyl-6-methylideneundecyl)-N-ethyl-N-methylhenicosa-13,16-dien-1-amine.
| Compound Name | (13Z,16E)-3-(9,10-dimethyl-6-methylideneundecyl)-N-ethyl-N-methylhenicosa-13,16-dien-1-amine |
|---|---|
| PubChem CID | 170072291 |
| Molecular Formula | C38H73N |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.57 |
| IUPAC Name | (13Z,16E)-3-(9,10-dimethyl-6-methylideneundecyl)-N-ethyl-N-methylhenicosa-13,16-dien-1-amine |
| SMILES | C=C(CCCCCC(CCCCCCCCC/C=C\C/C=C/CCCC)CCN(C)CC)CCC(C)C(C)C |
| InChI | InChI=1S/C38H73N/c1-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26-29-38(33-34-39(7)9-2)30-27-24-25-28-36(5)31-32-37(6)35(3)4/h12-13,15-16,35,37-38H,5,8-11,14,17-34H2,1-4,6-7H3/b13-12+,16-15- |
| InChIKey | VGBNSQZCGSTQMB-OKHIERNBSA-N |
| XLogP | 12.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|