C43H79N — CID 138714893
(Z)-N-ethyl-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-N-methyltricos-14-en-17-yn-1-amine (PubChem CID 138714893) has the molecular formula C43H79N and a molecular weight of 610.11 g/mol. Its IUPAC name is (Z)-N-ethyl-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-N-methyltricos-14-en-17-yn-1-amine.
| Compound Name | (Z)-N-ethyl-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-N-methyltricos-14-en-17-yn-1-amine |
|---|---|
| PubChem CID | 138714893 |
| Molecular Formula | C43H79N |
| Molecular Weight | 610.11 g/mol |
| Exact Mass | 609.62 |
| IUPAC Name | (Z)-N-ethyl-4-[(8Z,11Z)-heptadeca-8,11-dienyl]-N-methyltricos-14-en-17-yn-1-amine |
| SMILES | CCCCCC#CC/C=C\CCCCCCCCCC(CCCCCCC/C=C\C/C=C\CCCCC)CCCN(C)CC |
| InChI | InChI=1S/C43H79N/c1-5-8-10-12-14-16-18-20-22-23-25-27-29-31-33-35-37-40-43(41-38-42-44(4)7-3)39-36-34-32-30-28-26-24-21-19-17-15-13-11-9-6-2/h15,17,20-22,24,43H,5-13,18-19,23,25-42H2,1-4H3/b17-15-,22-20-,24-21- |
| InChIKey | KNMAXSNEIXTVMH-FPIVKKIXSA-N |
| XLogP | 14.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.11 |
| LogP ≤ 5 | 14.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|