C39H54N4NiO6-4 — CID 156749438
N,N-di(ethyl)ethanamine;methyl 2-cyclopropyl-5-ethoxy-4-[[2-[4-(2-ethoxyethylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate;nickel (PubChem CID 156749438) has the molecular formula C39H54N4NiO6-4 and a molecular weight of 733.58 g/mol. Its IUPAC name is N,N-di(ethyl)ethanamine;methyl 2-cyclopropyl-5-ethoxy-4-[[2-[4-(2-ethoxyethylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate;nickel.
| Compound Name | N,N-di(ethyl)ethanamine;methyl 2-cyclopropyl-5-ethoxy-4-[[2-[4-(2-ethoxyethylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate;nickel |
|---|---|
| PubChem CID | 156749438 |
| Molecular Formula | C39H54N4NiO6-4 |
| Molecular Weight | 733.58 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | N,N-di(ethyl)ethanamine;methyl 2-cyclopropyl-5-ethoxy-4-[[2-[4-(2-ethoxyethylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate;nickel |
| SMILES | [CH2-]CN(C[CH2-])C[CH2-].[CH2-]COCCNC(=O)c1ccc(N2CC3(CCN(Cc4cc(C5CC5)c(C(=O)OC)cc4OCC)CC3)CC2=O)cc1.[Ni] |
| InChI | InChI=1S/C33H42N3O6.C6H12N.Ni/c1-4-41-17-14-34-31(38)24-8-10-26(11-9-24)36-22-33(20-30(36)37)12-15-35(16-13-33)21-25-18-27(23-6-7-23)28(32(39)40-3)19-29(25)42-5-2;1-4-7(5-2)6-3;/h8-11,18-19,23H,1,4-7,12-17,20-22H2,2-3H3,(H,34,38);1-6H2;/q-1;-3; |
| InChIKey | AFACVPOMKCOJJN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|