C32H41N3O6 — CID 167353274
methyl 2-cyclopropyl-5-ethoxy-4-[[3-[4-(4-formamidobutyl)phenyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate (PubChem CID 167353274) has the molecular formula C32H41N3O6 and a molecular weight of 563.70 g/mol. Its IUPAC name is methyl 2-cyclopropyl-5-ethoxy-4-[[3-[4-(4-formamidobutyl)phenyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate.
| Compound Name | methyl 2-cyclopropyl-5-ethoxy-4-[[3-[4-(4-formamidobutyl)phenyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate |
|---|---|
| PubChem CID | 167353274 |
| Molecular Formula | C32H41N3O6 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | methyl 2-cyclopropyl-5-ethoxy-4-[[3-[4-(4-formamidobutyl)phenyl]-2-oxo-1-oxa-3,8-diazaspiro[4.5]decan-8-yl]methyl]benzoate |
| SMILES | CCOc1cc(C(=O)OC)c(C2CC2)cc1CN1CCC2(CC1)CN(c1ccc(CCCCNC=O)cc1)C(=O)O2 |
| InChI | InChI=1S/C32H41N3O6/c1-3-40-29-19-28(30(37)39-2)27(24-9-10-24)18-25(29)20-34-16-13-32(14-17-34)21-35(31(38)41-32)26-11-7-23(8-12-26)6-4-5-15-33-22-36/h7-8,11-12,18-19,22,24H,3-6,9-10,13-17,20-21H2,1-2H3,(H,33,36) |
| InChIKey | NDWVGIPAELSGKC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|