C33H44N4O5S — CID 156749437
methyl 4-[[2-[4-(4-aminosulfanylbutylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-cyclopropyl-5-ethoxybenzoate (PubChem CID 156749437) has the molecular formula C33H44N4O5S and a molecular weight of 608.81 g/mol. Its IUPAC name is methyl 4-[[2-[4-(4-aminosulfanylbutylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-cyclopropyl-5-ethoxybenzoate.
| Compound Name | methyl 4-[[2-[4-(4-aminosulfanylbutylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-cyclopropyl-5-ethoxybenzoate |
|---|---|
| PubChem CID | 156749437 |
| Molecular Formula | C33H44N4O5S |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | methyl 4-[[2-[4-(4-aminosulfanylbutylcarbamoyl)phenyl]-3-oxo-2,8-diazaspiro[4.5]decan-8-yl]methyl]-2-cyclopropyl-5-ethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OC)c(C2CC2)cc1CN1CCC2(CC1)CC(=O)N(c1ccc(C(=O)NCCCCSN)cc1)C2 |
| InChI | InChI=1S/C33H44N4O5S/c1-3-42-29-19-28(32(40)41-2)27(23-6-7-23)18-25(29)21-36-15-12-33(13-16-36)20-30(38)37(22-33)26-10-8-24(9-11-26)31(39)35-14-4-5-17-43-34/h8-11,18-19,23H,3-7,12-17,20-22,34H2,1-2H3,(H,35,39) |
| InChIKey | YVWDWOAMTGTUED-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|