C40H76N2O3 — CID 156751213
ethyl 9-[3-(dimethylamino)propyl-[(2Z,21Z)-tetracosa-2,21-dien-12-yl]amino]-9-oxononanoate (PubChem CID 156751213) has the molecular formula C40H76N2O3 and a molecular weight of 633.06 g/mol. Its IUPAC name is ethyl 9-[3-(dimethylamino)propyl-[(2Z,21Z)-tetracosa-2,21-dien-12-yl]amino]-9-oxononanoate.
| Compound Name | ethyl 9-[3-(dimethylamino)propyl-[(2Z,21Z)-tetracosa-2,21-dien-12-yl]amino]-9-oxononanoate |
|---|---|
| PubChem CID | 156751213 |
| Molecular Formula | C40H76N2O3 |
| Molecular Weight | 633.06 g/mol |
| Exact Mass | 632.59 |
| IUPAC Name | ethyl 9-[3-(dimethylamino)propyl-[(2Z,21Z)-tetracosa-2,21-dien-12-yl]amino]-9-oxononanoate |
| SMILES | C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CC)N(CCCN(C)C)C(=O)CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C40H76N2O3/c1-6-9-11-13-15-17-19-21-24-28-33-38(32-27-23-20-18-16-14-12-10-7-2)42(37-31-36-41(4)5)39(43)34-29-25-22-26-30-35-40(44)45-8-3/h7,9-11,38H,6,8,12-37H2,1-5H3/b10-7-,11-9- |
| InChIKey | YGDYESIUHCJGSP-HDEMWOFXSA-N |
| XLogP | 11.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.06 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|