C20H18ClN3O2 — CID 156753750
4-[5-(2-chloro-7-ethoxyquinolin-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]phenol (PubChem CID 156753750) has the molecular formula C20H18ClN3O2 and a molecular weight of 367.84 g/mol. Its IUPAC name is 4-[5-(2-chloro-7-ethoxyquinolin-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]phenol.
| Compound Name | 4-[5-(2-chloro-7-ethoxyquinolin-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
|---|---|
| PubChem CID | 156753750 |
| Molecular Formula | C20H18ClN3O2 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 4-[5-(2-chloro-7-ethoxyquinolin-3-yl)-4,5-dihydro-1H-pyrazol-3-yl]phenol |
| SMILES | CCOc1ccc2cc(C3CC(c4ccc(O)cc4)=NN3)c(Cl)nc2c1 |
| InChI | InChI=1S/C20H18ClN3O2/c1-2-26-15-8-5-13-9-16(20(21)22-17(13)10-15)19-11-18(23-24-19)12-3-6-14(25)7-4-12/h3-10,19,24-25H,2,11H2,1H3 |
| InChIKey | MNRKWWZRBGIPPR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|