C34H48N6O12 — CID 156755164
tert-butyl 4-[[(2R,3S)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate (PubChem CID 156755164) has the molecular formula C34H48N6O12 and a molecular weight of 732.79 g/mol. Its IUPAC name is tert-butyl 4-[[(2R,3S)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate.
| Compound Name | tert-butyl 4-[[(2R,3S)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 156755164 |
| Molecular Formula | C34H48N6O12 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.33 |
| IUPAC Name | tert-butyl 4-[[(2R,3S)-2,3-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)[C@@H](NC(=O)CCN1C(=O)C=CC1=O)[C@@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)NCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H48N6O12/c1-33(2,3)51-27(47)9-7-17-35-31(49)29(37-21(41)15-19-39-23(43)11-12-24(39)44)30(32(50)36-18-8-10-28(48)52-34(4,5)6)38-22(42)16-20-40-25(45)13-14-26(40)46/h11-14,29-30H,7-10,15-20H2,1-6H3,(H,35,49)(H,36,50)(H,37,41)(H,38,42)/t29-,30+ |
| InChIKey | MJOXFUPVXRHXCE-RNPORBBMSA-N |
| XLogP | -0.94 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|