C24H22N6O2 — CID 156755251
2-N-[3-(oxiran-2-ylmethoxy)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 156755251) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-N-[3-(oxiran-2-ylmethoxy)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[3-(oxiran-2-ylmethoxy)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 156755251 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-N-[3-(oxiran-2-ylmethoxy)phenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(Nc3ccccc3)nc(Nc3cccc(OCC4CO4)c3)n2)cc1 |
| InChI | InChI=1S/C24H22N6O2/c1-3-8-17(9-4-1)25-22-28-23(26-18-10-5-2-6-11-18)30-24(29-22)27-19-12-7-13-20(14-19)31-15-21-16-32-21/h1-14,21H,15-16H2,(H3,25,26,27,28,29,30) |
| InChIKey | WOPRPQYHUHEZRX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|