C20H18N2O4 — CID 156759245
4-[(5-cyclopropyloxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]aniline (PubChem CID 156759245) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-[(5-cyclopropyloxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]aniline.
| Compound Name | 4-[(5-cyclopropyloxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]aniline |
|---|---|
| PubChem CID | 156759245 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-[(5-cyclopropyloxy-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl)oxy]aniline |
| SMILES | Nc1ccc(Oc2ccnc3cc(OC4CC4)c4c(c23)OCCO4)cc1 |
| InChI | InChI=1S/C20H18N2O4/c21-12-1-3-13(4-2-12)25-16-7-8-22-15-11-17(26-14-5-6-14)19-20(18(15)16)24-10-9-23-19/h1-4,7-8,11,14H,5-6,9-10,21H2 |
| InChIKey | KABPFMLPKKXCQN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|