C14H9FN2O7 — CID 156760821
5-[(4-carboxy-2,5-dihydroxybenzoyl)amino]-2-fluoropyridine-4-carboxylic acid (PubChem CID 156760821) has the molecular formula C14H9FN2O7 and a molecular weight of 336.23 g/mol. Its IUPAC name is 5-[(4-carboxy-2,5-dihydroxybenzoyl)amino]-2-fluoropyridine-4-carboxylic acid.
| Compound Name | 5-[(4-carboxy-2,5-dihydroxybenzoyl)amino]-2-fluoropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 156760821 |
| Molecular Formula | C14H9FN2O7 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-[(4-carboxy-2,5-dihydroxybenzoyl)amino]-2-fluoropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(O)c(C(=O)Nc2cnc(F)cc2C(=O)O)cc1O |
| InChI | InChI=1S/C14H9FN2O7/c15-11-3-5(13(21)22)8(4-16-11)17-12(20)6-1-10(19)7(14(23)24)2-9(6)18/h1-4,18-19H,(H,17,20)(H,21,22)(H,23,24) |
| InChIKey | ZFQZVGUCRMRVCW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|