C13H10N2O8S — CID 156760744
4-[(2,5-dihydroxy-4-sulfobenzoyl)amino]pyridine-3-carboxylic acid (PubChem CID 156760744) has the molecular formula C13H10N2O8S and a molecular weight of 354.30 g/mol. Its IUPAC name is 4-[(2,5-dihydroxy-4-sulfobenzoyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 4-[(2,5-dihydroxy-4-sulfobenzoyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 156760744 |
| Molecular Formula | C13H10N2O8S |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-[(2,5-dihydroxy-4-sulfobenzoyl)amino]pyridine-3-carboxylic acid |
| SMILES | O=C(Nc1ccncc1C(=O)O)c1cc(O)c(S(=O)(=O)O)cc1O |
| InChI | InChI=1S/C13H10N2O8S/c16-9-4-11(24(21,22)23)10(17)3-6(9)12(18)15-8-1-2-14-5-7(8)13(19)20/h1-5,16-17H,(H,19,20)(H,14,15,18)(H,21,22,23) |
| InChIKey | MLROYVLTJSTQSO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 174.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|