C14H30N2O4S — CID 156761918
3-[2-[2-[2-(2-propoxyethoxy)ethylamino]ethylamino]ethylsulfanyl]propanoic acid (PubChem CID 156761918) has the molecular formula C14H30N2O4S and a molecular weight of 322.47 g/mol. Its IUPAC name is 3-[2-[2-[2-(2-propoxyethoxy)ethylamino]ethylamino]ethylsulfanyl]propanoic acid.
| Compound Name | 3-[2-[2-[2-(2-propoxyethoxy)ethylamino]ethylamino]ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 156761918 |
| Molecular Formula | C14H30N2O4S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[2-[2-[2-(2-propoxyethoxy)ethylamino]ethylamino]ethylsulfanyl]propanoic acid |
| SMILES | CCCOCCOCCNCCNCCSCCC(=O)O |
| InChI | InChI=1S/C14H30N2O4S/c1-2-8-19-10-11-20-9-6-15-4-5-16-7-13-21-12-3-14(17)18/h15-16H,2-13H2,1H3,(H,17,18) |
| InChIKey | SKCVVYCWBMMHRQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|