C31H30N6O7 — CID 156769937
1-cyclohexylperoxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate (PubChem CID 156769937) has the molecular formula C31H30N6O7 and a molecular weight of 598.62 g/mol. Its IUPAC name is 1-cyclohexylperoxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate.
| Compound Name | 1-cyclohexylperoxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 156769937 |
| Molecular Formula | C31H30N6O7 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 1-cyclohexylperoxycarbonyloxyethyl 2-oxo-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-1H-benzimidazole-4-carboxylate |
| SMILES | CC(OC(=O)OOC1CCCCC1)OC(=O)c1cccc2[nH]c(=O)n(Cc3ccc(-c4ccccc4-c4nn[nH]n4)cc3)c12 |
| InChI | InChI=1S/C31H30N6O7/c1-19(42-31(40)44-43-22-8-3-2-4-9-22)41-29(38)25-12-7-13-26-27(25)37(30(39)32-26)18-20-14-16-21(17-15-20)23-10-5-6-11-24(23)28-33-35-36-34-28/h5-7,10-17,19,22H,2-4,8-9,18H2,1H3,(H,32,39)(H,33,34,35,36) |
| InChIKey | WQAPCEZTFXUMSK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 163.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|