C13H18ClN3O3 — CID 156771550
methyl (3S)-3-[2-amino-5-chloro-4-(methylcarbamoyl)anilino]butanoate (PubChem CID 156771550) has the molecular formula C13H18ClN3O3 and a molecular weight of 299.76 g/mol. Its IUPAC name is methyl (3S)-3-[2-amino-5-chloro-4-(methylcarbamoyl)anilino]butanoate.
| Compound Name | methyl (3S)-3-[2-amino-5-chloro-4-(methylcarbamoyl)anilino]butanoate |
|---|---|
| PubChem CID | 156771550 |
| Molecular Formula | C13H18ClN3O3 |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | methyl (3S)-3-[2-amino-5-chloro-4-(methylcarbamoyl)anilino]butanoate |
| SMILES | CNC(=O)c1cc(N)c(N[C@@H](C)CC(=O)OC)cc1Cl |
| InChI | InChI=1S/C13H18ClN3O3/c1-7(4-12(18)20-3)17-11-6-9(14)8(5-10(11)15)13(19)16-2/h5-7,17H,4,15H2,1-3H3,(H,16,19)/t7-/m0/s1 |
| InChIKey | LXHSVNOGEDGZLL-ZETCQYMHSA-N |
| XLogP | 1.65 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|