C22H25N3O2 — CID 156772148
ethyl 2-(1H-indol-3-yl)-2-(4-piperazin-1-ylphenyl)acetate (PubChem CID 156772148) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl 2-(1H-indol-3-yl)-2-(4-piperazin-1-ylphenyl)acetate.
| Compound Name | ethyl 2-(1H-indol-3-yl)-2-(4-piperazin-1-ylphenyl)acetate |
|---|---|
| PubChem CID | 156772148 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | ethyl 2-(1H-indol-3-yl)-2-(4-piperazin-1-ylphenyl)acetate |
| SMILES | CCOC(=O)C(c1ccc(N2CCNCC2)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H25N3O2/c1-2-27-22(26)21(19-15-24-20-6-4-3-5-18(19)20)16-7-9-17(10-8-16)25-13-11-23-12-14-25/h3-10,15,21,23-24H,2,11-14H2,1H3 |
| InChIKey | YOPANANRPIEACX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |