C17H26O2 — CID 156773033
2,4,4,6,6,7,7,10-octamethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one (PubChem CID 156773033) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2,4,4,6,6,7,7,10-octamethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one.
| Compound Name | 2,4,4,6,6,7,7,10-octamethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one |
|---|---|
| PubChem CID | 156773033 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2,4,4,6,6,7,7,10-octamethyl-1-oxaspiro[4.5]deca-2,9-dien-8-one |
| SMILES | CC1=CC(C)(C)C2(O1)C(C)=CC(=O)C(C)(C)C2(C)C |
| InChI | InChI=1S/C17H26O2/c1-11-9-13(18)15(5,6)16(7,8)17(11)14(3,4)10-12(2)19-17/h9-10H,1-8H3 |
| InChIKey | ONCKNKZQHOPMHX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |