C14H6Br2N2O3 — CID 156779682
4,7-bis(5-bromofuran-2-yl)-2,1,3-benzoxadiazole (PubChem CID 156779682) has the molecular formula C14H6Br2N2O3 and a molecular weight of 410.02 g/mol. Its IUPAC name is 4,7-bis(5-bromofuran-2-yl)-2,1,3-benzoxadiazole.
| Compound Name | 4,7-bis(5-bromofuran-2-yl)-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 156779682 |
| Molecular Formula | C14H6Br2N2O3 |
| Molecular Weight | 410.02 g/mol |
| Exact Mass | 407.87 |
| IUPAC Name | 4,7-bis(5-bromofuran-2-yl)-2,1,3-benzoxadiazole |
| SMILES | Brc1ccc(-c2ccc(-c3ccc(Br)o3)c3nonc23)o1 |
| InChI | InChI=1S/C14H6Br2N2O3/c15-11-5-3-9(19-11)7-1-2-8(10-4-6-12(16)20-10)14-13(7)17-21-18-14/h1-6H |
| InChIKey | DMWRAEJMTXHAGE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |