C26H29NS — CID 156780290
1-phenyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine (PubChem CID 156780290) has the molecular formula C26H29NS and a molecular weight of 387.59 g/mol. Its IUPAC name is 1-phenyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine.
| Compound Name | 1-phenyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine |
|---|---|
| PubChem CID | 156780290 |
| Molecular Formula | C26H29NS |
| Molecular Weight | 387.59 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-phenyl-2-(2,4,4-trimethylpentan-2-yl)-10H-phenothiazine |
| SMILES | CC(C)(C)CC(C)(C)c1ccc2c(c1-c1ccccc1)Nc1ccccc1S2 |
| InChI | InChI=1S/C26H29NS/c1-25(2,3)17-26(4,5)19-15-16-22-24(23(19)18-11-7-6-8-12-18)27-20-13-9-10-14-21(20)28-22/h6-16,27H,17H2,1-5H3 |
| InChIKey | VIPVHFDSGKDOLW-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.59 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |