C12H11BrN4O2 — CID 156784787
3-(azidomethyl)-6-bromo-1,3-dimethylquinoline-2,4-dione (PubChem CID 156784787) has the molecular formula C12H11BrN4O2 and a molecular weight of 323.15 g/mol. Its IUPAC name is 3-(azidomethyl)-6-bromo-1,3-dimethylquinoline-2,4-dione.
| Compound Name | 3-(azidomethyl)-6-bromo-1,3-dimethylquinoline-2,4-dione |
|---|---|
| PubChem CID | 156784787 |
| Molecular Formula | C12H11BrN4O2 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-(azidomethyl)-6-bromo-1,3-dimethylquinoline-2,4-dione |
| SMILES | CN1C(=O)C(C)(CN=[N+]=[N-])C(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C12H11BrN4O2/c1-12(6-15-16-14)10(18)8-5-7(13)3-4-9(8)17(2)11(12)19/h3-5H,6H2,1-2H3 |
| InChIKey | GLLKWUXIOBDKEW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|