C11H12BrNOS — CID 84615700
7-bromo-2,2,4-trimethyl-1,4-benzothiazin-3-one (PubChem CID 84615700) has the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. Its IUPAC name is 7-bromo-2,2,4-trimethyl-1,4-benzothiazin-3-one.
| Compound Name | 7-bromo-2,2,4-trimethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615700 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 7-bromo-2,2,4-trimethyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)C(C)(C)Sc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H12BrNOS/c1-11(2)10(14)13(3)8-5-4-7(12)6-9(8)15-11/h4-6H,1-3H3 |
| InChIKey | QMLJOFSVINUZAN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |