About pyrano[3,4-c][1,8]naphthyridin-5-one
pyrano[3,4-c][1,8]naphthyridin-5-one (PubChem CID 156787160) has the molecular formula C11H6N2O2
and a molecular weight of 198.18 g/mol. Its IUPAC name is pyrano[3,4-c][1,8]naphthyridin-5-one.
Molecular Properties
| Compound Name | pyrano[3,4-c][1,8]naphthyridin-5-one |
| PubChem CID | 156787160 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | pyrano[3,4-c][1,8]naphthyridin-5-one |
| SMILES | O=c1nc2ncccc2c2ccocc1-2 |
| InChI | InChI=1S/C11H6N2O2/c14-11-9-6-15-5-3-7(9)8-2-1-4-12-10(8)13-11/h1-6H |
| InChIKey | MXSBAJMZDANYDC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrano[3,4-c][1,8]naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrano[3,4-c][1,8]naphthyridin-5-one?
The IUPAC name of pyrano[3,4-c][1,8]naphthyridin-5-one (CID 156787160) is pyrano[3,4-c][1,8]naphthyridin-5-one.
What is the SMILES notation for pyrano[3,4-c][1,8]naphthyridin-5-one?
The canonical SMILES for pyrano[3,4-c][1,8]naphthyridin-5-one is O=c1nc2ncccc2c2ccocc1-2.
What is the InChIKey of pyrano[3,4-c][1,8]naphthyridin-5-one?
The InChIKey is MXSBAJMZDANYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2/c14-11-9-6-15-5-3-7(9)8-2-1-4-12-10(8)13-11/h1-6H.
What are the key properties of pyrano[3,4-c][1,8]naphthyridin-5-one?
pyrano[3,4-c][1,8]naphthyridin-5-one has a molecular weight of 198.18 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrano[3,4-c][1,8]naphthyridin-5-one is sourced from PubChem (CID 156787160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).