C10H5BrOS — CID 156788125
1-bromothieno[2,3-b][1]benzofuran (PubChem CID 156788125) has the molecular formula C10H5BrOS and a molecular weight of 253.12 g/mol. Its IUPAC name is 1-bromothieno[2,3-b][1]benzofuran.
| Compound Name | 1-bromothieno[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 156788125 |
| Molecular Formula | C10H5BrOS |
| Molecular Weight | 253.12 g/mol |
| Exact Mass | 251.92 |
| IUPAC Name | 1-bromothieno[2,3-b][1]benzofuran |
| SMILES | Brc1csc2oc3ccccc3c12 |
| InChI | InChI=1S/C10H5BrOS/c11-7-5-13-10-9(7)6-3-1-2-4-8(6)12-10/h1-5H |
| InChIKey | ANMCJDVJFLFTAX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.12 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |