C11H19N3O2S2 — CID 156791421
2-amino-N-[amino-(5-methoxythiophen-3-yl)-λ4-sulfanylidene]-4-methylpentanamide (PubChem CID 156791421) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 2-amino-N-[amino-(5-methoxythiophen-3-yl)-λ4-sulfanylidene]-4-methylpentanamide.
| Compound Name | 2-amino-N-[amino-(5-methoxythiophen-3-yl)-λ4-sulfanylidene]-4-methylpentanamide |
|---|---|
| PubChem CID | 156791421 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-amino-N-[amino-(5-methoxythiophen-3-yl)-λ4-sulfanylidene]-4-methylpentanamide |
| SMILES | COc1cc(/S(N)=N/C(=O)C(N)CC(C)C)cs1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-7(2)4-9(12)11(15)14-18(13)8-5-10(16-3)17-6-8/h5-7,9H,4,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | JBAHKUGQOPYVGY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |