C11H16ClN3O3S2 — CID 177035504
(2S)-2-amino-N-[(4-chlorothiophen-2-yl)-formamido-oxo-λ6-sulfanylidene]-4-methylpentanamide (PubChem CID 177035504) has the molecular formula C11H16ClN3O3S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is (2S)-2-amino-N-[(4-chlorothiophen-2-yl)-formamido-oxo-λ6-sulfanylidene]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[(4-chlorothiophen-2-yl)-formamido-oxo-λ6-sulfanylidene]-4-methylpentanamide |
|---|---|
| PubChem CID | 177035504 |
| Molecular Formula | C11H16ClN3O3S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (2S)-2-amino-N-[(4-chlorothiophen-2-yl)-formamido-oxo-λ6-sulfanylidene]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N=S(=O)(NC=O)c1cc(Cl)cs1 |
| InChI | InChI=1S/C11H16ClN3O3S2/c1-7(2)3-9(13)11(17)15-20(18,14-6-16)10-4-8(12)5-19-10/h4-7,9H,3,13H2,1-2H3,(H,14,15,16,17,18)/t9-,20?/m0/s1 |
| InChIKey | JCUNNJJWYWLYMW-KMYGYIBBSA-N |
| XLogP | 1.79 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|