C8H10ClNO2S2 — CID 177035640
N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]propanamide (PubChem CID 177035640) has the molecular formula C8H10ClNO2S2 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]propanamide.
| Compound Name | N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]propanamide |
|---|---|
| PubChem CID | 177035640 |
| Molecular Formula | C8H10ClNO2S2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]propanamide |
| SMILES | C=S(=O)(NC(=O)CC)c1cc(Cl)cs1 |
| InChI | InChI=1S/C8H10ClNO2S2/c1-3-7(11)10-14(2,12)8-4-6(9)5-13-8/h4-5H,2-3H2,1H3,(H,10,11,12) |
| InChIKey | HPOSWWLCPARGKX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|