C9H14ClN3O2S2 — CID 177035556
(2S)-2,4-diamino-N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]butanamide (PubChem CID 177035556) has the molecular formula C9H14ClN3O2S2 and a molecular weight of 295.82 g/mol. Its IUPAC name is (2S)-2,4-diamino-N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]butanamide.
| Compound Name | (2S)-2,4-diamino-N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]butanamide |
|---|---|
| PubChem CID | 177035556 |
| Molecular Formula | C9H14ClN3O2S2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | (2S)-2,4-diamino-N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]butanamide |
| SMILES | C=S(=O)(NC(=O)[C@@H](N)CCN)c1cc(Cl)cs1 |
| InChI | InChI=1S/C9H14ClN3O2S2/c1-17(15,8-4-6(10)5-16-8)13-9(14)7(12)2-3-11/h4-5,7H,1-3,11-12H2,(H,13,14,15)/t7-,17?/m0/s1 |
| InChIKey | SRCPGMCWUTXYKM-ISJKBYAMSA-N |
| XLogP | 0.18 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|