C14H26ClN3O3S2 — CID 177035634
3-amino-5-methylhexan-2-one;N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]formamide;methanamine (PubChem CID 177035634) has the molecular formula C14H26ClN3O3S2 and a molecular weight of 383.97 g/mol. Its IUPAC name is 3-amino-5-methylhexan-2-one;N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]formamide;methanamine.
| Compound Name | 3-amino-5-methylhexan-2-one;N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]formamide;methanamine |
|---|---|
| PubChem CID | 177035634 |
| Molecular Formula | C14H26ClN3O3S2 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-amino-5-methylhexan-2-one;N-[(4-chlorothiophen-2-yl)-methylidene-oxo-λ6-sulfanyl]formamide;methanamine |
| SMILES | C=S(=O)(NC=O)c1cc(Cl)cs1.CC(=O)C(N)CC(C)C.CN |
| InChI | InChI=1S/C7H15NO.C6H6ClNO2S2.CH5N/c1-5(2)4-7(8)6(3)9;1-12(10,8-4-9)6-2-5(7)3-11-6;1-2/h5,7H,4,8H2,1-3H3;2-4H,1H2,(H,8,9,10);2H2,1H3 |
| InChIKey | XSYMJTGODCSARL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|