C15H27ClN2O3S2 — CID 177035473
3-amino-5-methylhexan-2-one;N-[(5-chlorothiophen-3-yl)-methylidene-oxo-λ6-sulfanyl]formamide;ethane (PubChem CID 177035473) has the molecular formula C15H27ClN2O3S2 and a molecular weight of 382.98 g/mol. Its IUPAC name is 3-amino-5-methylhexan-2-one;N-[(5-chlorothiophen-3-yl)-methylidene-oxo-λ6-sulfanyl]formamide;ethane.
| Compound Name | 3-amino-5-methylhexan-2-one;N-[(5-chlorothiophen-3-yl)-methylidene-oxo-λ6-sulfanyl]formamide;ethane |
|---|---|
| PubChem CID | 177035473 |
| Molecular Formula | C15H27ClN2O3S2 |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-amino-5-methylhexan-2-one;N-[(5-chlorothiophen-3-yl)-methylidene-oxo-λ6-sulfanyl]formamide;ethane |
| SMILES | C=S(=O)(NC=O)c1csc(Cl)c1.CC.CC(=O)C(N)CC(C)C |
| InChI | InChI=1S/C7H15NO.C6H6ClNO2S2.C2H6/c1-5(2)4-7(8)6(3)9;1-12(10,8-4-9)5-2-6(7)11-3-5;1-2/h5,7H,4,8H2,1-3H3;2-4H,1H2,(H,8,9,10);1-2H3 |
| InChIKey | AKYSKNAYTJUFPS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|