C37H51BN4O6 — CID 156792636
tert-butyl 4-[[3-methoxy-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 156792636) has the molecular formula C37H51BN4O6 and a molecular weight of 658.65 g/mol. Its IUPAC name is tert-butyl 4-[[3-methoxy-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-methoxy-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 156792636 |
| Molecular Formula | C37H51BN4O6 |
| Molecular Weight | 658.65 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | tert-butyl 4-[[3-methoxy-4-[1-(oxan-2-yl)-3-[(E)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]indazol-5-yl]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | COc1cc(CN2CCN(C(=O)OC(C)(C)C)CC2)ccc1-c1ccc2c(c1)c(/C=C/B1OC(C)(C)C(C)(C)O1)nn2C1CCCCO1 |
| InChI | InChI=1S/C37H51BN4O6/c1-35(2,3)46-34(43)41-20-18-40(19-21-41)25-26-12-14-28(32(23-26)44-8)27-13-15-31-29(24-27)30(39-42(31)33-11-9-10-22-45-33)16-17-38-47-36(4,5)37(6,7)48-38/h12-17,23-24,33H,9-11,18-22,25H2,1-8H3/b17-16+ |
| InChIKey | TYULSVALRWWDAF-WUKNDPDISA-N |
| XLogP | 7.11 |
| TPSA | 87.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.65 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|