C28H23FN4O4 — CID 156797367
13-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-4-fluoro-9,15-dioxo-19-oxa-16-azapentacyclo[10.7.1.02,10.03,8.016,20]icosa-1(20),2(10),3(8),4,6,11,13-heptaene-14-carbonitrile (PubChem CID 156797367) has the molecular formula C28H23FN4O4 and a molecular weight of 498.51 g/mol. Its IUPAC name is 13-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-4-fluoro-9,15-dioxo-19-oxa-16-azapentacyclo[10.7.1.02,10.03,8.016,20]icosa-1(20),2(10),3(8),4,6,11,13-heptaene-14-carbonitrile.
| Compound Name | 13-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-4-fluoro-9,15-dioxo-19-oxa-16-azapentacyclo[10.7.1.02,10.03,8.016,20]icosa-1(20),2(10),3(8),4,6,11,13-heptaene-14-carbonitrile |
|---|---|
| PubChem CID | 156797367 |
| Molecular Formula | C28H23FN4O4 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 13-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-4-fluoro-9,15-dioxo-19-oxa-16-azapentacyclo[10.7.1.02,10.03,8.016,20]icosa-1(20),2(10),3(8),4,6,11,13-heptaene-14-carbonitrile |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2c(C#N)c(=O)n3c4c(c5c(cc24)C(=O)c2cccc(F)c2-5)OCC3)C[C@H]1C |
| InChI | InChI=1S/C28H23FN4O4/c1-4-21(34)32-12-15(3)33(13-14(32)2)24-18-10-17-23(22-16(26(17)35)6-5-7-20(22)29)27-25(18)31(8-9-37-27)28(36)19(24)11-30/h4-7,10,14-15H,1,8-9,12-13H2,2-3H3/t14-,15+/m1/s1 |
| InChIKey | NOGXWYOOBPPPPO-CABCVRRESA-N |
| XLogP | 3.23 |
| TPSA | 95.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|