C18H27F3N2O3 — CID 156800031
tert-butyl 2-[[3-(8,8,8-trifluorooctan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate (PubChem CID 156800031) has the molecular formula C18H27F3N2O3 and a molecular weight of 376.42 g/mol. Its IUPAC name is tert-butyl 2-[[3-(8,8,8-trifluorooctan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[3-(8,8,8-trifluorooctan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 156800031 |
| Molecular Formula | C18H27F3N2O3 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | tert-butyl 2-[[3-(8,8,8-trifluorooctan-2-yl)-1,2,4-oxadiazol-5-yl]methyl]prop-2-enoate |
| SMILES | C=C(Cc1nc(C(C)CCCCCC(F)(F)F)no1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27F3N2O3/c1-12(9-7-6-8-10-18(19,20)21)15-22-14(26-23-15)11-13(2)16(24)25-17(3,4)5/h12H,2,6-11H2,1,3-5H3 |
| InChIKey | RCKAMDIFDCPIHI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|