About ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate
ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate (PubChem CID 15680103) has the molecular formula C15H18Cl2N2O2
and a molecular weight of 329.23 g/mol. Its IUPAC name is ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate |
| PubChem CID | 15680103 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)Cc1nc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-4-21-14(20)8-15(2,3)7-13-18-11-5-9(16)10(17)6-12(11)19-13/h5-6H,4,7-8H2,1-3H3,(H,18,19) |
| InChIKey | DZRVBDGTSPNGRC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate?
The IUPAC name of ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate (CID 15680103) is ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate is CCOC(=O)CC(C)(C)Cc1nc2cc(Cl)c(Cl)cc2[nH]1.
What is the InChIKey of ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate?
The InChIKey is DZRVBDGTSPNGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18Cl2N2O2/c1-4-21-14(20)8-15(2,3)7-13-18-11-5-9(16)10(17)6-12(11)19-13/h5-6H,4,7-8H2,1-3H3,(H,18,19).
What are the key properties of ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate?
ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate has a molecular weight of 329.23 g/mol, XLogP of 4.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5,6-dichloro-1H-benzimidazol-2-yl)-3,3-dimethylbutanoate is sourced from PubChem (CID 15680103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).